C7H14N2O — CID 105428381
8-oxa-2,3-diazaspiro[4.5]decane (PubChem CID 105428381) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 8-oxa-2,3-diazaspiro[4.5]decane.
| Compound Name | 8-oxa-2,3-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 105428381 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 8-oxa-2,3-diazaspiro[4.5]decane |
| SMILES | C1CC2(CCO1)CNNC2 |
| InChI | InChI=1S/C7H14N2O/c1-3-10-4-2-7(1)5-8-9-6-7/h8-9H,1-6H2 |
| InChIKey | NYTYHRSBNGHGGQ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |