C7H13FN2 — CID 105428656
8-fluoro-6-methyl-3,6-diazabicyclo[3.2.1]octane (PubChem CID 105428656) has the molecular formula C7H13FN2 and a molecular weight of 144.19 g/mol. Its IUPAC name is 8-fluoro-6-methyl-3,6-diazabicyclo[3.2.1]octane.
| Compound Name | 8-fluoro-6-methyl-3,6-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 105428656 |
| Molecular Formula | C7H13FN2 |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.11 |
| IUPAC Name | 8-fluoro-6-methyl-3,6-diazabicyclo[3.2.1]octane |
| SMILES | CN1CC2CNCC1C2F |
| InChI | InChI=1S/C7H13FN2/c1-10-4-5-2-9-3-6(10)7(5)8/h5-7,9H,2-4H2,1H3 |
| InChIKey | DIBXCLDBNSEFHI-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |