C6H12N2 — CID 22121937
3,6-diazabicyclo[3.2.1]octane (PubChem CID 22121937) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 3,6-diazabicyclo[3.2.1]octane.
| Compound Name | 3,6-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 22121937 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 3,6-diazabicyclo[3.2.1]octane |
| SMILES | C1NCC2CC1CN2 |
| InChI | InChI=1S/C6H12N2/c1-5-2-7-4-6(1)8-3-5/h5-8H,1-4H2 |
| InChIKey | ISGOOAZVDIZEMN-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |