C6H10FNS — CID 105429080
3,6-dihydro-2H-thiopyran-4-yl(fluoro)methanamine (PubChem CID 105429080) has the molecular formula C6H10FNS and a molecular weight of 147.22 g/mol. Its IUPAC name is 3,6-dihydro-2H-thiopyran-4-yl(fluoro)methanamine.
| Compound Name | 3,6-dihydro-2H-thiopyran-4-yl(fluoro)methanamine |
|---|---|
| PubChem CID | 105429080 |
| Molecular Formula | C6H10FNS |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 3,6-dihydro-2H-thiopyran-4-yl(fluoro)methanamine |
| SMILES | NC(F)C1=CCSCC1 |
| InChI | InChI=1S/C6H10FNS/c7-6(8)5-1-3-9-4-2-5/h1,6H,2-4,8H2 |
| InChIKey | WVOHXCMYJHHTNZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|