C7H12FNS — CID 105431710
2-(3,6-dihydro-2H-thiopyran-4-yl)-2-fluoroethanamine (PubChem CID 105431710) has the molecular formula C7H12FNS and a molecular weight of 161.24 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-thiopyran-4-yl)-2-fluoroethanamine.
| Compound Name | 2-(3,6-dihydro-2H-thiopyran-4-yl)-2-fluoroethanamine |
|---|---|
| PubChem CID | 105431710 |
| Molecular Formula | C7H12FNS |
| Molecular Weight | 161.24 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 2-(3,6-dihydro-2H-thiopyran-4-yl)-2-fluoroethanamine |
| SMILES | NCC(F)C1=CCSCC1 |
| InChI | InChI=1S/C7H12FNS/c8-7(5-9)6-1-3-10-4-2-6/h1,7H,2-5,9H2 |
| InChIKey | PYHGVLCGBKHZDR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|