C7H15N3O — CID 105430690
6-(2-aminoethyl)-1,4-diazepan-2-one (PubChem CID 105430690) has the molecular formula C7H15N3O and a molecular weight of 157.22 g/mol. Its IUPAC name is 6-(2-aminoethyl)-1,4-diazepan-2-one.
| Compound Name | 6-(2-aminoethyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 105430690 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | 6-(2-aminoethyl)-1,4-diazepan-2-one |
| SMILES | NCCC1CNCC(=O)NC1 |
| InChI | InChI=1S/C7H15N3O/c8-2-1-6-3-9-5-7(11)10-4-6/h6,9H,1-5,8H2,(H,10,11) |
| InChIKey | CORFDJBWIVTRMN-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |