C7H14N2O2 — CID 105430948
2-(2-hydroxyethyl)-1,5-dimethylpyrazolidin-3-one (PubChem CID 105430948) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-1,5-dimethylpyrazolidin-3-one.
| Compound Name | 2-(2-hydroxyethyl)-1,5-dimethylpyrazolidin-3-one |
|---|---|
| PubChem CID | 105430948 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-(2-hydroxyethyl)-1,5-dimethylpyrazolidin-3-one |
| SMILES | CC1CC(=O)N(CCO)N1C |
| InChI | InChI=1S/C7H14N2O2/c1-6-5-7(11)9(3-4-10)8(6)2/h6,10H,3-5H2,1-2H3 |
| InChIKey | VXPVDORMEIRGPR-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |