C8H16N2O2 — CID 19841685
4-(2-hydroxyethyl)-5-methyl-1,4-diazepan-2-one (PubChem CID 19841685) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-5-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(2-hydroxyethyl)-5-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 19841685 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 4-(2-hydroxyethyl)-5-methyl-1,4-diazepan-2-one |
| SMILES | CC1CCNC(=O)CN1CCO |
| InChI | InChI=1S/C8H16N2O2/c1-7-2-3-9-8(12)6-10(7)4-5-11/h7,11H,2-6H2,1H3,(H,9,12) |
| InChIKey | WJJKZEVETKKQRS-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |