About 4-(2-hydroxyethyl)-1,4-diazepan-2-one
4-(2-hydroxyethyl)-1,4-diazepan-2-one (PubChem CID 14574145) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 4-(2-hydroxyethyl)-1,4-diazepan-2-one |
| PubChem CID | 14574145 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 4-(2-hydroxyethyl)-1,4-diazepan-2-one |
| SMILES | O=C1CN(CCO)CCCN1 |
| InChI | InChI=1S/C7H14N2O2/c10-5-4-9-3-1-2-8-7(11)6-9/h10H,1-6H2,(H,8,11) |
| InChIKey | JUSIXMQXCRDUIA-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-hydroxyethyl)-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxyethyl)-1,4-diazepan-2-one?
The IUPAC name of 4-(2-hydroxyethyl)-1,4-diazepan-2-one (CID 14574145) is 4-(2-hydroxyethyl)-1,4-diazepan-2-one.
What is the SMILES notation for 4-(2-hydroxyethyl)-1,4-diazepan-2-one?
The canonical SMILES for 4-(2-hydroxyethyl)-1,4-diazepan-2-one is O=C1CN(CCO)CCCN1.
What is the InChIKey of 4-(2-hydroxyethyl)-1,4-diazepan-2-one?
The InChIKey is JUSIXMQXCRDUIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c10-5-4-9-3-1-2-8-7(11)6-9/h10H,1-6H2,(H,8,11).
What are the key properties of 4-(2-hydroxyethyl)-1,4-diazepan-2-one?
4-(2-hydroxyethyl)-1,4-diazepan-2-one has a molecular weight of 158.20 g/mol, XLogP of -1.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxyethyl)-1,4-diazepan-2-one is sourced from PubChem (CID 14574145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).