About 4-(5-aminopentyl)-1,4-diazepan-2-one
4-(5-aminopentyl)-1,4-diazepan-2-one (PubChem CID 65361478) has the molecular formula C10H21N3O
and a molecular weight of 199.30 g/mol. Its IUPAC name is 4-(5-aminopentyl)-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 4-(5-aminopentyl)-1,4-diazepan-2-one |
| PubChem CID | 65361478 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 4-(5-aminopentyl)-1,4-diazepan-2-one |
| SMILES | NCCCCCN1CCCNC(=O)C1 |
| InChI | InChI=1S/C10H21N3O/c11-5-2-1-3-7-13-8-4-6-12-10(14)9-13/h1-9,11H2,(H,12,14) |
| InChIKey | PFHUCTLGPJYUCZ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-aminopentyl)-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-aminopentyl)-1,4-diazepan-2-one?
The IUPAC name of 4-(5-aminopentyl)-1,4-diazepan-2-one (CID 65361478) is 4-(5-aminopentyl)-1,4-diazepan-2-one.
What is the SMILES notation for 4-(5-aminopentyl)-1,4-diazepan-2-one?
The canonical SMILES for 4-(5-aminopentyl)-1,4-diazepan-2-one is NCCCCCN1CCCNC(=O)C1.
What is the InChIKey of 4-(5-aminopentyl)-1,4-diazepan-2-one?
The InChIKey is PFHUCTLGPJYUCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O/c11-5-2-1-3-7-13-8-4-6-12-10(14)9-13/h1-9,11H2,(H,12,14).
What are the key properties of 4-(5-aminopentyl)-1,4-diazepan-2-one?
4-(5-aminopentyl)-1,4-diazepan-2-one has a molecular weight of 199.30 g/mol, XLogP of -0.06, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-aminopentyl)-1,4-diazepan-2-one is sourced from PubChem (CID 65361478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).