C15H31N5O — CID 43253120
1-[2-[4-(5-aminopentyl)-1,4-diazepan-1-yl]ethyl]imidazolidin-2-one (PubChem CID 43253120) has the molecular formula C15H31N5O and a molecular weight of 297.45 g/mol. Its IUPAC name is 1-[2-[4-(5-aminopentyl)-1,4-diazepan-1-yl]ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-[4-(5-aminopentyl)-1,4-diazepan-1-yl]ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 43253120 |
| Molecular Formula | C15H31N5O |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | 1-[2-[4-(5-aminopentyl)-1,4-diazepan-1-yl]ethyl]imidazolidin-2-one |
| SMILES | NCCCCCN1CCCN(CCN2CCNC2=O)CC1 |
| InChI | InChI=1S/C15H31N5O/c16-5-2-1-3-7-18-8-4-9-19(12-11-18)13-14-20-10-6-17-15(20)21/h1-14,16H2,(H,17,21) |
| InChIKey | PDPYHNOWJKQOES-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|