C12H20N2O2 — CID 104750873
4-(2-cyclopentyl-2-oxoethyl)-1,4-diazepan-2-one (PubChem CID 104750873) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-(2-cyclopentyl-2-oxoethyl)-1,4-diazepan-2-one.
| Compound Name | 4-(2-cyclopentyl-2-oxoethyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 104750873 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 4-(2-cyclopentyl-2-oxoethyl)-1,4-diazepan-2-one |
| SMILES | O=C1CN(CC(=O)C2CCCC2)CCCN1 |
| InChI | InChI=1S/C12H20N2O2/c15-11(10-4-1-2-5-10)8-14-7-3-6-13-12(16)9-14/h10H,1-9H2,(H,13,16) |
| InChIKey | YTUYMEOERNLJEH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |