About N-methyl-1-(2-methyl-7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanamine
N-methyl-1-(2-methyl-7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanamine (PubChem CID 105431723) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is N-methyl-1-(2-methyl-7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanamine.
Molecular Properties
| Compound Name | N-methyl-1-(2-methyl-7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanamine |
| PubChem CID | 105431723 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | N-methyl-1-(2-methyl-7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanamine |
| SMILES | CNCC1Cc2c(C)cccc21 |
| InChI | InChI=1S/C11H15N/c1-8-4-3-5-10-9(7-12-2)6-11(8)10/h3-5,9,12H,6-7H2,1-2H3 |
| InChIKey | QFORFAJOSPJDKH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-1-(2-methyl-7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(2-methyl-7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanamine?
The IUPAC name of N-methyl-1-(2-methyl-7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanamine (CID 105431723) is N-methyl-1-(2-methyl-7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanamine.
What is the SMILES notation for N-methyl-1-(2-methyl-7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanamine?
The canonical SMILES for N-methyl-1-(2-methyl-7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanamine is CNCC1Cc2c(C)cccc21.
What is the InChIKey of N-methyl-1-(2-methyl-7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanamine?
The InChIKey is QFORFAJOSPJDKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N/c1-8-4-3-5-10-9(7-12-2)6-11(8)10/h3-5,9,12H,6-7H2,1-2H3.
What are the key properties of N-methyl-1-(2-methyl-7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanamine?
N-methyl-1-(2-methyl-7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanamine has a molecular weight of 161.25 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(2-methyl-7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanamine is sourced from PubChem (CID 105431723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).