About 2-ethyl-4,6-dihydrofuro[3,4-c]pyrazole-3-carbonitrile
2-ethyl-4,6-dihydrofuro[3,4-c]pyrazole-3-carbonitrile (PubChem CID 105432065) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-ethyl-4,6-dihydrofuro[3,4-c]pyrazole-3-carbonitrile.
Analyze 2-ethyl-4,6-dihydrofuro[3,4-c]pyrazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4,6-dihydrofuro[3,4-c]pyrazole-3-carbonitrile?
The IUPAC name of 2-ethyl-4,6-dihydrofuro[3,4-c]pyrazole-3-carbonitrile (CID 105432065) is 2-ethyl-4,6-dihydrofuro[3,4-c]pyrazole-3-carbonitrile.
What is the SMILES notation for 2-ethyl-4,6-dihydrofuro[3,4-c]pyrazole-3-carbonitrile?
The canonical SMILES for 2-ethyl-4,6-dihydrofuro[3,4-c]pyrazole-3-carbonitrile is CCn1nc2c(c1C#N)COC2.
What is the InChIKey of 2-ethyl-4,6-dihydrofuro[3,4-c]pyrazole-3-carbonitrile?
The InChIKey is ZFHHJYBDNVRJPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-2-11-8(3-9)6-4-12-5-7(6)10-11/h2,4-5H2,1H3.
What are the key properties of 2-ethyl-4,6-dihydrofuro[3,4-c]pyrazole-3-carbonitrile?
2-ethyl-4,6-dihydrofuro[3,4-c]pyrazole-3-carbonitrile has a molecular weight of 163.18 g/mol, XLogP of 0.80, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4,6-dihydrofuro[3,4-c]pyrazole-3-carbonitrile is sourced from PubChem (CID 105432065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).