C9H15N3 — CID 105432804
1-(5-cyclobutyl-1H-pyrazol-4-yl)-N-methylmethanamine (PubChem CID 105432804) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 1-(5-cyclobutyl-1H-pyrazol-4-yl)-N-methylmethanamine.
| Compound Name | 1-(5-cyclobutyl-1H-pyrazol-4-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105432804 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 1-(5-cyclobutyl-1H-pyrazol-4-yl)-N-methylmethanamine |
| SMILES | CNCc1cn[nH]c1C1CCC1 |
| InChI | InChI=1S/C9H15N3/c1-10-5-8-6-11-12-9(8)7-3-2-4-7/h6-7,10H,2-5H2,1H3,(H,11,12) |
| InChIKey | VJKGICWCAYLZFL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |