C8H13NO3 — CID 105434715
3-(5,5-dimethyl-3-oxo-1,2-oxazolidin-2-yl)propanal (PubChem CID 105434715) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 3-(5,5-dimethyl-3-oxo-1,2-oxazolidin-2-yl)propanal.
| Compound Name | 3-(5,5-dimethyl-3-oxo-1,2-oxazolidin-2-yl)propanal |
|---|---|
| PubChem CID | 105434715 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 3-(5,5-dimethyl-3-oxo-1,2-oxazolidin-2-yl)propanal |
| SMILES | CC1(C)CC(=O)N(CCC=O)O1 |
| InChI | InChI=1S/C8H13NO3/c1-8(2)6-7(11)9(12-8)4-3-5-10/h5H,3-4,6H2,1-2H3 |
| InChIKey | UYQOBXYUPYKUCZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|