C7H11NO3 — CID 143011935
3,6,6-trimethyl-1,3-oxazinane-2,4-dione (PubChem CID 143011935) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 3,6,6-trimethyl-1,3-oxazinane-2,4-dione.
| Compound Name | 3,6,6-trimethyl-1,3-oxazinane-2,4-dione |
|---|---|
| PubChem CID | 143011935 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 3,6,6-trimethyl-1,3-oxazinane-2,4-dione |
| SMILES | CN1C(=O)CC(C)(C)OC1=O |
| InChI | InChI=1S/C7H11NO3/c1-7(2)4-5(9)8(3)6(10)11-7/h4H2,1-3H3 |
| InChIKey | TUROMJUESTXRGJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |