About methane;3,5,5-trimethyl-1,3-oxazolidine-2,4-dione
methane;3,5,5-trimethyl-1,3-oxazolidine-2,4-dione (PubChem CID 157467246) has the molecular formula C7H13NO3
and a molecular weight of 159.19 g/mol. Its IUPAC name is methane;3,5,5-trimethyl-1,3-oxazolidine-2,4-dione.
Analyze methane;3,5,5-trimethyl-1,3-oxazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3,5,5-trimethyl-1,3-oxazolidine-2,4-dione?
The IUPAC name of methane;3,5,5-trimethyl-1,3-oxazolidine-2,4-dione (CID 157467246) is methane;3,5,5-trimethyl-1,3-oxazolidine-2,4-dione.
What is the SMILES notation for methane;3,5,5-trimethyl-1,3-oxazolidine-2,4-dione?
The canonical SMILES for methane;3,5,5-trimethyl-1,3-oxazolidine-2,4-dione is C.CN1C(=O)OC(C)(C)C1=O.
What is the InChIKey of methane;3,5,5-trimethyl-1,3-oxazolidine-2,4-dione?
The InChIKey is OIEYHGDLKPGPAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3.CH4/c1-6(2)4(8)7(3)5(9)10-6;/h1-3H3;1H4.
What are the key properties of methane;3,5,5-trimethyl-1,3-oxazolidine-2,4-dione?
methane;3,5,5-trimethyl-1,3-oxazolidine-2,4-dione has a molecular weight of 159.19 g/mol, XLogP of 1.01, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3,5,5-trimethyl-1,3-oxazolidine-2,4-dione is sourced from PubChem (CID 157467246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).