C13H18N2O2 — CID 82339584
6-(2-aminoethyl)-2,2,4-trimethyl-1,4-benzoxazin-3-one (PubChem CID 82339584) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 6-(2-aminoethyl)-2,2,4-trimethyl-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-aminoethyl)-2,2,4-trimethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82339584 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 6-(2-aminoethyl)-2,2,4-trimethyl-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)C(C)(C)Oc2ccc(CCN)cc21 |
| InChI | InChI=1S/C13H18N2O2/c1-13(2)12(16)15(3)10-8-9(6-7-14)4-5-11(10)17-13/h4-5,8H,6-7,14H2,1-3H3 |
| InChIKey | ABXAUPBSQUZCPP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |