C7H13N3O — CID 145461138
2-amino-3,6,6-trimethyl-5H-pyrimidin-4-one (PubChem CID 145461138) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 2-amino-3,6,6-trimethyl-5H-pyrimidin-4-one.
| Compound Name | 2-amino-3,6,6-trimethyl-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 145461138 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 2-amino-3,6,6-trimethyl-5H-pyrimidin-4-one |
| SMILES | CN1C(=O)CC(C)(C)N=C1N |
| InChI | InChI=1S/C7H13N3O/c1-7(2)4-5(11)10(3)6(8)9-7/h4H2,1-3H3,(H2,8,9) |
| InChIKey | MDUKNALFVKMSGF-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |