C18H33N3O — CID 156742922
acetylene;2-amino-3-(cyclopropylmethyl)-6,6-dimethyl-5H-pyrimidin-4-one;ethane (PubChem CID 156742922) has the molecular formula C18H33N3O and a molecular weight of 307.48 g/mol. Its IUPAC name is acetylene;2-amino-3-(cyclopropylmethyl)-6,6-dimethyl-5H-pyrimidin-4-one;ethane.
| Compound Name | acetylene;2-amino-3-(cyclopropylmethyl)-6,6-dimethyl-5H-pyrimidin-4-one;ethane |
|---|---|
| PubChem CID | 156742922 |
| Molecular Formula | C18H33N3O |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.26 |
| IUPAC Name | acetylene;2-amino-3-(cyclopropylmethyl)-6,6-dimethyl-5H-pyrimidin-4-one;ethane |
| SMILES | C#C.C#C.CC.CC.CC1(C)CC(=O)N(CC2CC2)C(N)=N1 |
| InChI | InChI=1S/C10H17N3O.2C2H6.2C2H2/c1-10(2)5-8(14)13(9(11)12-10)6-7-3-4-7;4*1-2/h7H,3-6H2,1-2H3,(H2,11,12);2*1-2H3;2*1-2H |
| InChIKey | XSEKOQSNMPFUTH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|