C8H7N3O2 — CID 105436739
7-methoxy-[1,2,4]triazolo[4,3-a]pyridine-3-carbaldehyde (PubChem CID 105436739) has the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. Its IUPAC name is 7-methoxy-[1,2,4]triazolo[4,3-a]pyridine-3-carbaldehyde.
| Compound Name | 7-methoxy-[1,2,4]triazolo[4,3-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 105436739 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 7-methoxy-[1,2,4]triazolo[4,3-a]pyridine-3-carbaldehyde |
| SMILES | COc1ccn2c(C=O)nnc2c1 |
| InChI | InChI=1S/C8H7N3O2/c1-13-6-2-3-11-7(4-6)9-10-8(11)5-12/h2-5H,1H3 |
| InChIKey | VQVCBJPAOKIDFO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|