C11H13N3OS — CID 117142917
7-methoxy-3-(thiolan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 117142917) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 7-methoxy-3-(thiolan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 7-methoxy-3-(thiolan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 117142917 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 7-methoxy-3-(thiolan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | COc1ccn2c(C3CCSC3)nnc2c1 |
| InChI | InChI=1S/C11H13N3OS/c1-15-9-2-4-14-10(6-9)12-13-11(14)8-3-5-16-7-8/h2,4,6,8H,3,5,7H2,1H3 |
| InChIKey | ZYBBSQGOVUOZJL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |