C10H10BrN3S — CID 117138737
6-bromo-3-(thiolan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 117138737) has the molecular formula C10H10BrN3S and a molecular weight of 284.18 g/mol. Its IUPAC name is 6-bromo-3-(thiolan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 6-bromo-3-(thiolan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 117138737 |
| Molecular Formula | C10H10BrN3S |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 6-bromo-3-(thiolan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Brc1ccc2nnc(C3CCSC3)n2c1 |
| InChI | InChI=1S/C10H10BrN3S/c11-8-1-2-9-12-13-10(14(9)5-8)7-3-4-15-6-7/h1-2,5,7H,3-4,6H2 |
| InChIKey | OWSMKHZPHNFZSV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |