C12H13BrN2S — CID 117251630
1-bromo-7-methyl-3-(thiolan-3-yl)imidazo[1,5-a]pyridine (PubChem CID 117251630) has the molecular formula C12H13BrN2S and a molecular weight of 297.22 g/mol. Its IUPAC name is 1-bromo-7-methyl-3-(thiolan-3-yl)imidazo[1,5-a]pyridine.
| Compound Name | 1-bromo-7-methyl-3-(thiolan-3-yl)imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117251630 |
| Molecular Formula | C12H13BrN2S |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 1-bromo-7-methyl-3-(thiolan-3-yl)imidazo[1,5-a]pyridine |
| SMILES | Cc1ccn2c(C3CCSC3)nc(Br)c2c1 |
| InChI | InChI=1S/C12H13BrN2S/c1-8-2-4-15-10(6-8)11(13)14-12(15)9-3-5-16-7-9/h2,4,6,9H,3,5,7H2,1H3 |
| InChIKey | JRHYARBDRLJUOE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |