C9H14N4 — CID 105437702
5-[2-(1-aminocyclopropyl)ethyl]pyrimidin-4-amine (PubChem CID 105437702) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 5-[2-(1-aminocyclopropyl)ethyl]pyrimidin-4-amine.
| Compound Name | 5-[2-(1-aminocyclopropyl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 105437702 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 5-[2-(1-aminocyclopropyl)ethyl]pyrimidin-4-amine |
| SMILES | Nc1ncncc1CCC1(N)CC1 |
| InChI | InChI=1S/C9H14N4/c10-8-7(5-12-6-13-8)1-2-9(11)3-4-9/h5-6H,1-4,11H2,(H2,10,12,13) |
| InChIKey | ZNZZIJXTMSYNNH-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |