C12H14N2S — CID 105473191
1-[2-(1,2-benzothiazol-7-yl)ethyl]cyclopropan-1-amine (PubChem CID 105473191) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 1-[2-(1,2-benzothiazol-7-yl)ethyl]cyclopropan-1-amine.
| Compound Name | 1-[2-(1,2-benzothiazol-7-yl)ethyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 105473191 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1-[2-(1,2-benzothiazol-7-yl)ethyl]cyclopropan-1-amine |
| SMILES | NC1(CCc2cccc3cnsc23)CC1 |
| InChI | InChI=1S/C12H14N2S/c13-12(6-7-12)5-4-9-2-1-3-10-8-14-15-11(9)10/h1-3,8H,4-7,13H2 |
| InChIKey | FOLBKOMSUUOVGK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |