2-(1,2-benzothiazol-7-yl)ethanesulfinic acid

C9H9NO2S2 — CID 91179527

IUPAC2-(1,2-benzothiazol-7-yl)ethanesulfinic acid
SMILESO=S(O)CCc1cccc2cnsc12
InChIInChI=1S/C9H9NO2S2/c11-14(12)5-4-7-2-1-3-8-6-10-13-9(7)8/h1-3,6H,4-5H2,(H,11,12)
InChIKeyUNORGCSUGLCVRR-UHFFFAOYSA-N
MW227.31 g/mol
LogP2.06
Rot. Bonds3

About 2-(1,2-benzothiazol-7-yl)ethanesulfinic acid

2-(1,2-benzothiazol-7-yl)ethanesulfinic acid (PubChem CID 91179527) has the molecular formula C9H9NO2S2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-(1,2-benzothiazol-7-yl)ethanesulfinic acid.

Molecular Properties

Compound Name2-(1,2-benzothiazol-7-yl)ethanesulfinic acid
PubChem CID91179527
Molecular FormulaC9H9NO2S2
Molecular Weight227.31 g/mol
Exact Mass227.01
IUPAC Name2-(1,2-benzothiazol-7-yl)ethanesulfinic acid
SMILESO=S(O)CCc1cccc2cnsc12
InChIInChI=1S/C9H9NO2S2/c11-14(12)5-4-7-2-1-3-8-6-10-13-9(7)8/h1-3,6H,4-5H2,(H,11,12)
InChIKeyUNORGCSUGLCVRR-UHFFFAOYSA-N
XLogP2.06
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.31
LogP ≤ 52.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 2-(1,2-benzothiazol-7-yl)ethanesulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,2-benzothiazol-7-yl)ethanesulfinic acid?
The IUPAC name of 2-(1,2-benzothiazol-7-yl)ethanesulfinic acid (CID 91179527) is 2-(1,2-benzothiazol-7-yl)ethanesulfinic acid.
What is the SMILES notation for 2-(1,2-benzothiazol-7-yl)ethanesulfinic acid?
The canonical SMILES for 2-(1,2-benzothiazol-7-yl)ethanesulfinic acid is O=S(O)CCc1cccc2cnsc12.
What is the InChIKey of 2-(1,2-benzothiazol-7-yl)ethanesulfinic acid?
The InChIKey is UNORGCSUGLCVRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S2/c11-14(12)5-4-7-2-1-3-8-6-10-13-9(7)8/h1-3,6H,4-5H2,(H,11,12).
What are the key properties of 2-(1,2-benzothiazol-7-yl)ethanesulfinic acid?
2-(1,2-benzothiazol-7-yl)ethanesulfinic acid has a molecular weight of 227.31 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-benzothiazol-7-yl)ethanesulfinic acid is sourced from PubChem (CID 91179527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).