C9H9NO2S2 — CID 91179527
2-(1,2-benzothiazol-7-yl)ethanesulfinic acid (PubChem CID 91179527) has the molecular formula C9H9NO2S2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-(1,2-benzothiazol-7-yl)ethanesulfinic acid.
| Compound Name | 2-(1,2-benzothiazol-7-yl)ethanesulfinic acid |
|---|---|
| PubChem CID | 91179527 |
| Molecular Formula | C9H9NO2S2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | 2-(1,2-benzothiazol-7-yl)ethanesulfinic acid |
| SMILES | O=S(O)CCc1cccc2cnsc12 |
| InChI | InChI=1S/C9H9NO2S2/c11-14(12)5-4-7-2-1-3-8-6-10-13-9(7)8/h1-3,6H,4-5H2,(H,11,12) |
| InChIKey | UNORGCSUGLCVRR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|