C19H11NS — CID 162767558
phenanthro[1,2-g][1,2]benzothiazole (PubChem CID 162767558) has the molecular formula C19H11NS and a molecular weight of 285.37 g/mol. Its IUPAC name is phenanthro[1,2-g][1,2]benzothiazole.
| Compound Name | phenanthro[1,2-g][1,2]benzothiazole |
|---|---|
| PubChem CID | 162767558 |
| Molecular Formula | C19H11NS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | phenanthro[1,2-g][1,2]benzothiazole |
| SMILES | c1ccc2c(c1)ccc1c2ccc2c1ccc1cnsc12 |
| InChI | InChI=1S/C19H11NS/c1-2-4-14-12(3-1)5-7-16-15(14)9-10-18-17(16)8-6-13-11-20-21-19(13)18/h1-11H |
| InChIKey | KKVMEGNFLGCUBM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|