C14H8S4 — CID 141291373
naphtho[1,2-h][1,2,3,4]benzotetrathiine (PubChem CID 141291373) has the molecular formula C14H8S4 and a molecular weight of 304.49 g/mol. Its IUPAC name is naphtho[1,2-h][1,2,3,4]benzotetrathiine.
| Compound Name | naphtho[1,2-h][1,2,3,4]benzotetrathiine |
|---|---|
| PubChem CID | 141291373 |
| Molecular Formula | C14H8S4 |
| Molecular Weight | 304.49 g/mol |
| Exact Mass | 303.95 |
| IUPAC Name | naphtho[1,2-h][1,2,3,4]benzotetrathiine |
| SMILES | c1ccc2c(c1)ccc1c2ccc2ssssc21 |
| InChI | InChI=1S/C14H8S4/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-14(12)16-18-17-15-13/h1-8H |
| InChIKey | WPXVKVMWINKOSB-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.49 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|