C10H10N2S — CID 117281991
(E)-3-(1,2-benzothiazol-7-yl)prop-2-en-1-amine (PubChem CID 117281991) has the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. Its IUPAC name is (E)-3-(1,2-benzothiazol-7-yl)prop-2-en-1-amine.
| Compound Name | (E)-3-(1,2-benzothiazol-7-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 117281991 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (E)-3-(1,2-benzothiazol-7-yl)prop-2-en-1-amine |
| SMILES | NC/C=C/c1cccc2cnsc12 |
| InChI | InChI=1S/C10H10N2S/c11-6-2-5-8-3-1-4-9-7-12-13-10(8)9/h1-5,7H,6,11H2/b5-2+ |
| InChIKey | VXDBWVHQNZYEAK-GORDUTHDSA-N |
| XLogP | 2.27 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |