About 2-cyclopropyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine
2-cyclopropyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine (PubChem CID 105438148) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-cyclopropyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine.
Molecular Properties
| Compound Name | 2-cyclopropyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine |
| PubChem CID | 105438148 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 2-cyclopropyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine |
| SMILES | Nc1c2c(nn1C1CC1)CCOC2 |
| InChI | InChI=1S/C9H13N3O/c10-9-7-5-13-4-3-8(7)11-12(9)6-1-2-6/h6H,1-5,10H2 |
| InChIKey | PHXOEEXQLGQRKC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopropyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine?
The IUPAC name of 2-cyclopropyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine (CID 105438148) is 2-cyclopropyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine.
What is the SMILES notation for 2-cyclopropyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine?
The canonical SMILES for 2-cyclopropyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine is Nc1c2c(nn1C1CC1)CCOC2.
What is the InChIKey of 2-cyclopropyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine?
The InChIKey is PHXOEEXQLGQRKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O/c10-9-7-5-13-4-3-8(7)11-12(9)6-1-2-6/h6H,1-5,10H2.
What are the key properties of 2-cyclopropyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine?
2-cyclopropyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine has a molecular weight of 179.22 g/mol, XLogP of 0.87, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine is sourced from PubChem (CID 105438148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).