C11H17N3O2 — CID 105480660
1-(oxan-4-yl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazol-3-amine (PubChem CID 105480660) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 1-(oxan-4-yl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazol-3-amine.
| Compound Name | 1-(oxan-4-yl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazol-3-amine |
|---|---|
| PubChem CID | 105480660 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 1-(oxan-4-yl)-5,7-dihydro-4H-pyrano[4,3-d]pyrazol-3-amine |
| SMILES | Nc1nn(C2CCOCC2)c2c1CCOC2 |
| InChI | InChI=1S/C11H17N3O2/c12-11-9-3-6-16-7-10(9)14(13-11)8-1-4-15-5-2-8/h8H,1-7H2,(H2,12,13) |
| InChIKey | BMOWZGPHDWAJBV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |