C11H17N3O — CID 105460780
1-cyclohexyl-4,6-dihydrofuro[3,4-d]pyrazol-3-amine (PubChem CID 105460780) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 1-cyclohexyl-4,6-dihydrofuro[3,4-d]pyrazol-3-amine.
| Compound Name | 1-cyclohexyl-4,6-dihydrofuro[3,4-d]pyrazol-3-amine |
|---|---|
| PubChem CID | 105460780 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 1-cyclohexyl-4,6-dihydrofuro[3,4-d]pyrazol-3-amine |
| SMILES | Nc1nn(C2CCCCC2)c2c1COC2 |
| InChI | InChI=1S/C11H17N3O/c12-11-9-6-15-7-10(9)14(13-11)8-4-2-1-3-5-8/h8H,1-7H2,(H2,12,13) |
| InChIKey | FXECQUHDQXRUSK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |