C11H10ClN3O — CID 83868838
1-(4-chlorophenyl)-4,6-dihydrofuro[3,4-d]pyrazol-3-amine (PubChem CID 83868838) has the molecular formula C11H10ClN3O and a molecular weight of 235.67 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4,6-dihydrofuro[3,4-d]pyrazol-3-amine.
| Compound Name | 1-(4-chlorophenyl)-4,6-dihydrofuro[3,4-d]pyrazol-3-amine |
|---|---|
| PubChem CID | 83868838 |
| Molecular Formula | C11H10ClN3O |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 1-(4-chlorophenyl)-4,6-dihydrofuro[3,4-d]pyrazol-3-amine |
| SMILES | Nc1nn(-c2ccc(Cl)cc2)c2c1COC2 |
| InChI | InChI=1S/C11H10ClN3O/c12-7-1-3-8(4-2-7)15-10-6-16-5-9(10)11(13)14-15/h1-4H,5-6H2,(H2,13,14) |
| InChIKey | RNTRZUUWNVRYPS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |