C12H12N2O2 — CID 105469602
4-(3-methyl-4,6-dihydrofuro[3,4-d]pyrazol-1-yl)phenol (PubChem CID 105469602) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-(3-methyl-4,6-dihydrofuro[3,4-d]pyrazol-1-yl)phenol.
| Compound Name | 4-(3-methyl-4,6-dihydrofuro[3,4-d]pyrazol-1-yl)phenol |
|---|---|
| PubChem CID | 105469602 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 4-(3-methyl-4,6-dihydrofuro[3,4-d]pyrazol-1-yl)phenol |
| SMILES | Cc1nn(-c2ccc(O)cc2)c2c1COC2 |
| InChI | InChI=1S/C12H12N2O2/c1-8-11-6-16-7-12(11)14(13-8)9-2-4-10(15)5-3-9/h2-5,15H,6-7H2,1H3 |
| InChIKey | VTKZIGQRUJXHPY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |