C11H9ClN2O2 — CID 105498313
1-(4-chlorophenyl)-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one (PubChem CID 105498313) has the molecular formula C11H9ClN2O2 and a molecular weight of 236.66 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one.
| Compound Name | 1-(4-chlorophenyl)-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one |
|---|---|
| PubChem CID | 105498313 |
| Molecular Formula | C11H9ClN2O2 |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 1-(4-chlorophenyl)-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one |
| SMILES | O=c1[nH]n(-c2ccc(Cl)cc2)c2c1COC2 |
| InChI | InChI=1S/C11H9ClN2O2/c12-7-1-3-8(4-2-7)14-10-6-16-5-9(10)11(15)13-14/h1-4H,5-6H2,(H,13,15) |
| InChIKey | FTAGMEAJDUGNCW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |