C19H16ClNO — CID 165354564
10-(4-chlorophenyl)-1,2,3,4-tetrahydroacridin-9-one (PubChem CID 165354564) has the molecular formula C19H16ClNO and a molecular weight of 309.80 g/mol. Its IUPAC name is 10-(4-chlorophenyl)-1,2,3,4-tetrahydroacridin-9-one.
| Compound Name | 10-(4-chlorophenyl)-1,2,3,4-tetrahydroacridin-9-one |
|---|---|
| PubChem CID | 165354564 |
| Molecular Formula | C19H16ClNO |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 10-(4-chlorophenyl)-1,2,3,4-tetrahydroacridin-9-one |
| SMILES | O=c1c2c(n(-c3ccc(Cl)cc3)c3ccccc13)CCCC2 |
| InChI | InChI=1S/C19H16ClNO/c20-13-9-11-14(12-10-13)21-17-7-3-1-5-15(17)19(22)16-6-2-4-8-18(16)21/h1,3,5,7,9-12H,2,4,6,8H2 |
| InChIKey | BSZBMHNGKQXOJQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |