C35H31N3 — CID 58663550
5-[4-(3,5-diphenylpyrazol-1-yl)phenyl]-6,7,8,9,10,11-hexahydrocycloocta[b]indole (PubChem CID 58663550) has the molecular formula C35H31N3 and a molecular weight of 493.65 g/mol. Its IUPAC name is 5-[4-(3,5-diphenylpyrazol-1-yl)phenyl]-6,7,8,9,10,11-hexahydrocycloocta[b]indole.
| Compound Name | 5-[4-(3,5-diphenylpyrazol-1-yl)phenyl]-6,7,8,9,10,11-hexahydrocycloocta[b]indole |
|---|---|
| PubChem CID | 58663550 |
| Molecular Formula | C35H31N3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 5-[4-(3,5-diphenylpyrazol-1-yl)phenyl]-6,7,8,9,10,11-hexahydrocycloocta[b]indole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)n(-c3ccc(-n4c5c(c6ccccc64)CCCCCC5)cc3)n2)cc1 |
| InChI | InChI=1S/C35H31N3/c1-2-10-19-33-30(17-9-1)31-18-11-12-20-34(31)37(33)28-21-23-29(24-22-28)38-35(27-15-7-4-8-16-27)25-32(36-38)26-13-5-3-6-14-26/h3-8,11-16,18,20-25H,1-2,9-10,17,19H2 |
| InChIKey | GTUYNFPFKXBCSP-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |