C64H44N6 — CID 71016751
1,5-bis[4-(3,5-diphenylpyrazol-1-yl)phenyl]-2,6-diphenylpyrrolo[2,3-f]indole (PubChem CID 71016751) has the molecular formula C64H44N6 and a molecular weight of 897.10 g/mol. Its IUPAC name is 1,5-bis[4-(3,5-diphenylpyrazol-1-yl)phenyl]-2,6-diphenylpyrrolo[2,3-f]indole.
| Compound Name | 1,5-bis[4-(3,5-diphenylpyrazol-1-yl)phenyl]-2,6-diphenylpyrrolo[2,3-f]indole |
|---|---|
| PubChem CID | 71016751 |
| Molecular Formula | C64H44N6 |
| Molecular Weight | 897.10 g/mol |
| Exact Mass | 896.36 |
| IUPAC Name | 1,5-bis[4-(3,5-diphenylpyrazol-1-yl)phenyl]-2,6-diphenylpyrrolo[2,3-f]indole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)n(-c3ccc(-n4c(-c5ccccc5)cc5cc6c(cc(-c7ccccc7)n6-c6ccc(-n7nc(-c8ccccc8)cc7-c7ccccc7)cc6)cc54)cc3)n2)cc1 |
| InChI | InChI=1S/C64H44N6/c1-7-19-45(20-8-1)57-43-63(49-27-15-5-16-28-49)69(65-57)55-35-31-53(32-36-55)67-59(47-23-11-3-12-24-47)39-51-42-62-52(41-61(51)67)40-60(48-25-13-4-14-26-48)68(62)54-33-37-56(38-34-54)70-64(50-29-17-6-18-30-50)44-58(66-70)46-21-9-2-10-22-46/h1-44H |
| InChIKey | QCAJBZHVPOEBGO-UHFFFAOYSA-N |
| XLogP | 15.95 |
| TPSA | 45.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.10 |
| LogP ≤ 5 | 15.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |