C39H29N5 — CID 90055339
9-(4,6-diphenyl-1,3,5-triazin-2-yl)-14-phenyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15(20)-heptaene (PubChem CID 90055339) has the molecular formula C39H29N5 and a molecular weight of 567.70 g/mol. Its IUPAC name is 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-14-phenyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15(20)-heptaene.
| Compound Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-14-phenyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15(20)-heptaene |
|---|---|
| PubChem CID | 90055339 |
| Molecular Formula | C39H29N5 |
| Molecular Weight | 567.70 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-14-phenyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15(20)-heptaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-n3c4ccccc4c4c5c6c(n(-c7ccccc7)c5ccc43)CCCC6)n2)cc1 |
| InChI | InChI=1S/C39H29N5/c1-4-14-26(15-5-1)37-40-38(27-16-6-2-7-17-27)42-39(41-37)44-32-23-13-11-21-30(32)36-34(44)25-24-33-35(36)29-20-10-12-22-31(29)43(33)28-18-8-3-9-19-28/h1-9,11,13-19,21,23-25H,10,12,20,22H2 |
| InChIKey | ZVHALUJOSGBHHJ-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.70 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |