C8H6ClN3O2 — CID 5305598
4-(4-chlorophenyl)-1,2,4-triazolidine-3,5-dione (PubChem CID 5305598) has the molecular formula C8H6ClN3O2 and a molecular weight of 211.61 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-(4-chlorophenyl)-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 5305598 |
| Molecular Formula | C8H6ClN3O2 |
| Molecular Weight | 211.61 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | 4-(4-chlorophenyl)-1,2,4-triazolidine-3,5-dione |
| SMILES | O=c1[nH][nH]c(=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H6ClN3O2/c9-5-1-3-6(4-2-5)12-7(13)10-11-8(12)14/h1-4H,(H,10,13)(H,11,14) |
| InChIKey | SQLIARONYUYNQT-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.61 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |