C8H6ClN3OS — CID 2743225
4-(3-chlorophenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one (PubChem CID 2743225) has the molecular formula C8H6ClN3OS and a molecular weight of 227.68 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one.
| Compound Name | 4-(3-chlorophenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 2743225 |
| Molecular Formula | C8H6ClN3OS |
| Molecular Weight | 227.68 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 4-(3-chlorophenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
| SMILES | O=c1[nH][nH]c(=S)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C8H6ClN3OS/c9-5-2-1-3-6(4-5)12-7(13)10-11-8(12)14/h1-4H,(H,10,13)(H,11,14) |
| InChIKey | CFANXGSAYYGHNO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 53.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.68 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|