C9H17N5 — CID 117123271
4-(aminomethyl)-1-cyclopentylpyrazole-3,5-diamine (PubChem CID 117123271) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is 4-(aminomethyl)-1-cyclopentylpyrazole-3,5-diamine.
| Compound Name | 4-(aminomethyl)-1-cyclopentylpyrazole-3,5-diamine |
|---|---|
| PubChem CID | 117123271 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 4-(aminomethyl)-1-cyclopentylpyrazole-3,5-diamine |
| SMILES | NCc1c(N)nn(C2CCCC2)c1N |
| InChI | InChI=1S/C9H17N5/c10-5-7-8(11)13-14(9(7)12)6-3-1-2-4-6/h6H,1-5,10,12H2,(H2,11,13) |
| InChIKey | IZFXLNHYCCQDMI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 95.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |