C8H11N3O2 — CID 105439294
5-(ethylaminomethyl)pyrazine-2-carboxylic acid (PubChem CID 105439294) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 5-(ethylaminomethyl)pyrazine-2-carboxylic acid.
| Compound Name | 5-(ethylaminomethyl)pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 105439294 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 5-(ethylaminomethyl)pyrazine-2-carboxylic acid |
| SMILES | CCNCc1cnc(C(=O)O)cn1 |
| InChI | InChI=1S/C8H11N3O2/c1-2-9-3-6-4-11-7(5-10-6)8(12)13/h4-5,9H,2-3H2,1H3,(H,12,13) |
| InChIKey | XLBMATQYLVYRBI-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |