5-ethylpyrazine-2-carboxamide;molecular hydrogen

C7H11N3O — CID 176985944

IUPAC5-ethylpyrazine-2-carboxamide;molecular hydrogen
SMILESCCc1cnc(C(N)=O)cn1.[H][H]
InChIInChI=1S/C7H9N3O.H2/c1-2-5-3-10-6(4-9-5)7(8)11;/h3-4H,2H2,1H3,(H2,8,11);1H
InChIKeyDWVVCYSUZUDNSB-UHFFFAOYSA-N
MW153.19 g/mol
LogP0.38
Rot. Bonds2

About 5-ethylpyrazine-2-carboxamide;molecular hydrogen

5-ethylpyrazine-2-carboxamide;molecular hydrogen (PubChem CID 176985944) has the molecular formula C7H11N3O and a molecular weight of 153.19 g/mol. Its IUPAC name is 5-ethylpyrazine-2-carboxamide;molecular hydrogen.

Molecular Properties

Compound Name5-ethylpyrazine-2-carboxamide;molecular hydrogen
PubChem CID176985944
Molecular FormulaC7H11N3O
Molecular Weight153.19 g/mol
Exact Mass153.09
IUPAC Name5-ethylpyrazine-2-carboxamide;molecular hydrogen
SMILESCCc1cnc(C(N)=O)cn1.[H][H]
InChIInChI=1S/C7H9N3O.H2/c1-2-5-3-10-6(4-9-5)7(8)11;/h3-4H,2H2,1H3,(H2,8,11);1H
InChIKeyDWVVCYSUZUDNSB-UHFFFAOYSA-N
XLogP0.38
TPSA68.87 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.19
LogP ≤ 50.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-ethylpyrazine-2-carboxamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-ethylpyrazine-2-carboxamide;molecular hydrogen?
The IUPAC name of 5-ethylpyrazine-2-carboxamide;molecular hydrogen (CID 176985944) is 5-ethylpyrazine-2-carboxamide;molecular hydrogen.
What is the SMILES notation for 5-ethylpyrazine-2-carboxamide;molecular hydrogen?
The canonical SMILES for 5-ethylpyrazine-2-carboxamide;molecular hydrogen is CCc1cnc(C(N)=O)cn1.[H][H].
What is the InChIKey of 5-ethylpyrazine-2-carboxamide;molecular hydrogen?
The InChIKey is DWVVCYSUZUDNSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O.H2/c1-2-5-3-10-6(4-9-5)7(8)11;/h3-4H,2H2,1H3,(H2,8,11);1H.
What are the key properties of 5-ethylpyrazine-2-carboxamide;molecular hydrogen?
5-ethylpyrazine-2-carboxamide;molecular hydrogen has a molecular weight of 153.19 g/mol, XLogP of 0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylpyrazine-2-carboxamide;molecular hydrogen is sourced from PubChem (CID 176985944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).