C9H11FN2O — CID 105439971
1-(4-fluoro-4,5,6,7-tetrahydro-1H-indazol-3-yl)ethanone (PubChem CID 105439971) has the molecular formula C9H11FN2O and a molecular weight of 182.20 g/mol. Its IUPAC name is 1-(4-fluoro-4,5,6,7-tetrahydro-1H-indazol-3-yl)ethanone.
| Compound Name | 1-(4-fluoro-4,5,6,7-tetrahydro-1H-indazol-3-yl)ethanone |
|---|---|
| PubChem CID | 105439971 |
| Molecular Formula | C9H11FN2O |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-(4-fluoro-4,5,6,7-tetrahydro-1H-indazol-3-yl)ethanone |
| SMILES | CC(=O)c1n[nH]c2c1C(F)CCC2 |
| InChI | InChI=1S/C9H11FN2O/c1-5(13)9-8-6(10)3-2-4-7(8)11-12-9/h6H,2-4H2,1H3,(H,11,12) |
| InChIKey | JIWYMLAJZWFIIT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |