About methyl 2-(1-aminoethyl)-4,5-dihydro-1,3-thiazole-4-carboxylate
methyl 2-(1-aminoethyl)-4,5-dihydro-1,3-thiazole-4-carboxylate (PubChem CID 105443216) has the molecular formula C7H12N2O2S
and a molecular weight of 188.25 g/mol. Its IUPAC name is methyl 2-(1-aminoethyl)-4,5-dihydro-1,3-thiazole-4-carboxylate.
Analyze methyl 2-(1-aminoethyl)-4,5-dihydro-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1-aminoethyl)-4,5-dihydro-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 2-(1-aminoethyl)-4,5-dihydro-1,3-thiazole-4-carboxylate (CID 105443216) is methyl 2-(1-aminoethyl)-4,5-dihydro-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 2-(1-aminoethyl)-4,5-dihydro-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 2-(1-aminoethyl)-4,5-dihydro-1,3-thiazole-4-carboxylate is COC(=O)C1CSC(C(C)N)=N1.
What is the InChIKey of methyl 2-(1-aminoethyl)-4,5-dihydro-1,3-thiazole-4-carboxylate?
The InChIKey is IXRDCPNXBLRDPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2S/c1-4(8)6-9-5(3-12-6)7(10)11-2/h4-5H,3,8H2,1-2H3.
What are the key properties of methyl 2-(1-aminoethyl)-4,5-dihydro-1,3-thiazole-4-carboxylate?
methyl 2-(1-aminoethyl)-4,5-dihydro-1,3-thiazole-4-carboxylate has a molecular weight of 188.25 g/mol, XLogP of 0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1-aminoethyl)-4,5-dihydro-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 105443216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).