C10H17F2N — CID 105443649
1-(2-cyclopropyl-3,3-difluorobutyl)cyclopropan-1-amine (PubChem CID 105443649) has the molecular formula C10H17F2N and a molecular weight of 189.25 g/mol. Its IUPAC name is 1-(2-cyclopropyl-3,3-difluorobutyl)cyclopropan-1-amine.
| Compound Name | 1-(2-cyclopropyl-3,3-difluorobutyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 105443649 |
| Molecular Formula | C10H17F2N |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-(2-cyclopropyl-3,3-difluorobutyl)cyclopropan-1-amine |
| SMILES | CC(F)(F)C(CC1(N)CC1)C1CC1 |
| InChI | InChI=1S/C10H17F2N/c1-9(11,12)8(7-2-3-7)6-10(13)4-5-10/h7-8H,2-6,13H2,1H3 |
| InChIKey | VLSAZTKTYGSLBS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |