About methyl 2-[(3R,4S)-4-aminothian-3-yl]acetate
methyl 2-[(3R,4S)-4-aminothian-3-yl]acetate (PubChem CID 105443914) has the molecular formula C8H15NO2S
and a molecular weight of 189.28 g/mol. Its IUPAC name is methyl 2-[(3R,4S)-4-aminothian-3-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(3R,4S)-4-aminothian-3-yl]acetate |
| PubChem CID | 105443914 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | methyl 2-[(3R,4S)-4-aminothian-3-yl]acetate |
| SMILES | COC(=O)C[C@H]1CSCC[C@@H]1N |
| InChI | InChI=1S/C8H15NO2S/c1-11-8(10)4-6-5-12-3-2-7(6)9/h6-7H,2-5,9H2,1H3/t6-,7-/m0/s1 |
| InChIKey | BLYYWQFGDODAIZ-BQBZGAKWSA-N |
| XLogP | 0.63 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[(3R,4S)-4-aminothian-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3R,4S)-4-aminothian-3-yl]acetate?
The IUPAC name of methyl 2-[(3R,4S)-4-aminothian-3-yl]acetate (CID 105443914) is methyl 2-[(3R,4S)-4-aminothian-3-yl]acetate.
What is the SMILES notation for methyl 2-[(3R,4S)-4-aminothian-3-yl]acetate?
The canonical SMILES for methyl 2-[(3R,4S)-4-aminothian-3-yl]acetate is COC(=O)C[C@H]1CSCC[C@@H]1N.
What is the InChIKey of methyl 2-[(3R,4S)-4-aminothian-3-yl]acetate?
The InChIKey is BLYYWQFGDODAIZ-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H15NO2S/c1-11-8(10)4-6-5-12-3-2-7(6)9/h6-7H,2-5,9H2,1H3/t6-,7-/m0/s1.
What are the key properties of methyl 2-[(3R,4S)-4-aminothian-3-yl]acetate?
methyl 2-[(3R,4S)-4-aminothian-3-yl]acetate has a molecular weight of 189.28 g/mol, XLogP of 0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3R,4S)-4-aminothian-3-yl]acetate is sourced from PubChem (CID 105443914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).